C9H10BrF3N2 — CID 107286484
2-[5-bromo-2-(trifluoromethyl)phenyl]-1,1-dimethylhydrazine (PubChem CID 107286484) has the molecular formula C9H10BrF3N2 and a molecular weight of 283.09 g/mol. Its IUPAC name is 2-[5-bromo-2-(trifluoromethyl)phenyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[5-bromo-2-(trifluoromethyl)phenyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 107286484 |
| Molecular Formula | C9H10BrF3N2 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 2-[5-bromo-2-(trifluoromethyl)phenyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C9H10BrF3N2/c1-15(2)14-8-5-6(10)3-4-7(8)9(11,12)13/h3-5,14H,1-2H3 |
| InChIKey | UOYSXKNAVQCJIW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|