C14H19BrF3N — CID 107286355
5-bromo-N-(4-methylhexan-2-yl)-2-(trifluoromethyl)aniline (PubChem CID 107286355) has the molecular formula C14H19BrF3N and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-bromo-N-(4-methylhexan-2-yl)-2-(trifluoromethyl)aniline.
| Compound Name | 5-bromo-N-(4-methylhexan-2-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107286355 |
| Molecular Formula | C14H19BrF3N |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 5-bromo-N-(4-methylhexan-2-yl)-2-(trifluoromethyl)aniline |
| SMILES | CCC(C)CC(C)Nc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H19BrF3N/c1-4-9(2)7-10(3)19-13-8-11(15)5-6-12(13)14(16,17)18/h5-6,8-10,19H,4,7H2,1-3H3 |
| InChIKey | QYLWSDFRXXAHKJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |