C11H13BrF3NO2 — CID 106186614
2-[5-bromo-2-(trifluoromethyl)anilino]-3-methoxypropan-1-ol (PubChem CID 106186614) has the molecular formula C11H13BrF3NO2 and a molecular weight of 328.13 g/mol. Its IUPAC name is 2-[5-bromo-2-(trifluoromethyl)anilino]-3-methoxypropan-1-ol.
| Compound Name | 2-[5-bromo-2-(trifluoromethyl)anilino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106186614 |
| Molecular Formula | C11H13BrF3NO2 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[5-bromo-2-(trifluoromethyl)anilino]-3-methoxypropan-1-ol |
| SMILES | COCC(CO)Nc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NO2/c1-18-6-8(5-17)16-10-4-7(12)2-3-9(10)11(13,14)15/h2-4,8,16-17H,5-6H2,1H3 |
| InChIKey | VCULYTXSIRHWQV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |