C10H9BrF3N5 — CID 107286159
5-bromo-N-[1-(2H-tetrazol-5-yl)ethyl]-2-(trifluoromethyl)aniline (PubChem CID 107286159) has the molecular formula C10H9BrF3N5 and a molecular weight of 336.12 g/mol. Its IUPAC name is 5-bromo-N-[1-(2H-tetrazol-5-yl)ethyl]-2-(trifluoromethyl)aniline.
| Compound Name | 5-bromo-N-[1-(2H-tetrazol-5-yl)ethyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107286159 |
| Molecular Formula | C10H9BrF3N5 |
| Molecular Weight | 336.12 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-bromo-N-[1-(2H-tetrazol-5-yl)ethyl]-2-(trifluoromethyl)aniline |
| SMILES | CC(Nc1cc(Br)ccc1C(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C10H9BrF3N5/c1-5(9-16-18-19-17-9)15-8-4-6(11)2-3-7(8)10(12,13)14/h2-5,15H,1H3,(H,16,17,18,19) |
| InChIKey | UMPLBPGNCJADBF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |