C13H18FNO2 — CID 10728696
N-benzyl-2-fluoro-3-hydroxy-2,3-dimethylbutan-1-imine oxide (PubChem CID 10728696) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is N-benzyl-2-fluoro-3-hydroxy-2,3-dimethylbutan-1-imine oxide.
| Compound Name | N-benzyl-2-fluoro-3-hydroxy-2,3-dimethylbutan-1-imine oxide |
|---|---|
| PubChem CID | 10728696 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-benzyl-2-fluoro-3-hydroxy-2,3-dimethylbutan-1-imine oxide |
| SMILES | CC(C)(O)C(C)(F)/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C13H18FNO2/c1-12(2,16)13(3,14)10-15(17)9-11-7-5-4-6-8-11/h4-8,10,16H,9H2,1-3H3/b15-10- |
| InChIKey | YFCUYPNOEYARJS-GDNBJRDFSA-N |
| XLogP | 2.27 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|