C14H16F4O — CID 107287864
2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopentan-1-ol (PubChem CID 107287864) has the molecular formula C14H16F4O and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopentan-1-ol.
| Compound Name | 2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 107287864 |
| Molecular Formula | C14H16F4O |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-ethyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopentan-1-ol |
| SMILES | CCC1CCCC1(O)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H16F4O/c1-2-9-4-3-7-13(9,19)10-5-6-11(12(15)8-10)14(16,17)18/h5-6,8-9,19H,2-4,7H2,1H3 |
| InChIKey | CNVMMGWMAZPFHM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |