C13H13ClF4 — CID 107290355
4-(3-chloro-1-methylcyclopentyl)-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 107290355) has the molecular formula C13H13ClF4 and a molecular weight of 280.69 g/mol. Its IUPAC name is 4-(3-chloro-1-methylcyclopentyl)-2-fluoro-1-(trifluoromethyl)benzene.
| Compound Name | 4-(3-chloro-1-methylcyclopentyl)-2-fluoro-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 107290355 |
| Molecular Formula | C13H13ClF4 |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-(3-chloro-1-methylcyclopentyl)-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | CC1(c2ccc(C(F)(F)F)c(F)c2)CCC(Cl)C1 |
| InChI | InChI=1S/C13H13ClF4/c1-12(5-4-9(14)7-12)8-2-3-10(11(15)6-8)13(16,17)18/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | VERAVFTUVJYAMD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|