About 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene
4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 107290351) has the molecular formula C15H15ClF4
and a molecular weight of 306.73 g/mol. Its IUPAC name is 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene |
| PubChem CID | 107290351 |
| Molecular Formula | C15H15ClF4 |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | CC1(C)CC(c2ccc(C(F)(F)F)c(F)c2)=CC(Cl)C1 |
| InChI | InChI=1S/C15H15ClF4/c1-14(2)7-10(5-11(16)8-14)9-3-4-12(13(17)6-9)15(18,19)20/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | YERBSUGPTGCMMI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene?
The IUPAC name of 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene (CID 107290351) is 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene.
What is the SMILES notation for 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene?
The canonical SMILES for 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene is CC1(C)CC(c2ccc(C(F)(F)F)c(F)c2)=CC(Cl)C1.
What is the InChIKey of 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene?
The InChIKey is YERBSUGPTGCMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClF4/c1-14(2)7-10(5-11(16)8-14)9-3-4-12(13(17)6-9)15(18,19)20/h3-6,11H,7-8H2,1-2H3.
What are the key properties of 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene?
4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene has a molecular weight of 306.73 g/mol, XLogP of 5.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene is sourced from PubChem (CID 107290351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).