C15H15ClF4 — CID 107290351
4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 107290351) has the molecular formula C15H15ClF4 and a molecular weight of 306.73 g/mol. Its IUPAC name is 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene.
| Compound Name | 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 107290351 |
| Molecular Formula | C15H15ClF4 |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-(3-chloro-5,5-dimethylcyclohexen-1-yl)-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | CC1(C)CC(c2ccc(C(F)(F)F)c(F)c2)=CC(Cl)C1 |
| InChI | InChI=1S/C15H15ClF4/c1-14(2)7-10(5-11(16)8-14)9-3-4-12(13(17)6-9)15(18,19)20/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | YERBSUGPTGCMMI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|