C13H17F4N — CID 107290717
N-ethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]butan-1-amine (PubChem CID 107290717) has the molecular formula C13H17F4N and a molecular weight of 263.28 g/mol. Its IUPAC name is N-ethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]butan-1-amine.
| Compound Name | N-ethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 107290717 |
| Molecular Formula | C13H17F4N |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-ethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]butan-1-amine |
| SMILES | CCNCCC(C)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F4N/c1-3-18-7-6-9(2)10-4-5-12(14)11(8-10)13(15,16)17/h4-5,8-9,18H,3,6-7H2,1-2H3 |
| InChIKey | KMIKFLWOYSGCML-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|