C12H8BrF4NS — CID 107291801
(5-bromothiophen-3-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine (PubChem CID 107291801) has the molecular formula C12H8BrF4NS and a molecular weight of 354.17 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (5-bromothiophen-3-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 107291801 |
| Molecular Formula | C12H8BrF4NS |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | (5-bromothiophen-3-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine |
| SMILES | NC(c1csc(Br)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8BrF4NS/c13-10-4-7(5-19-10)11(18)6-1-2-9(14)8(3-6)12(15,16)17/h1-5,11H,18H2 |
| InChIKey | HDDGVHTVPIWVTI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |