C15H13F4N — CID 115790064
[4-fluoro-3-(trifluoromethyl)phenyl]-(3-methylphenyl)methanamine (PubChem CID 115790064) has the molecular formula C15H13F4N and a molecular weight of 283.27 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]-(3-methylphenyl)methanamine.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(3-methylphenyl)methanamine |
|---|---|
| PubChem CID | 115790064 |
| Molecular Formula | C15H13F4N |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(3-methylphenyl)methanamine |
| SMILES | Cc1cccc(C(N)c2ccc(F)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H13F4N/c1-9-3-2-4-10(7-9)14(20)11-5-6-13(16)12(8-11)15(17,18)19/h2-8,14H,20H2,1H3 |
| InChIKey | SMTQDYMOMKRZLC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |