C13H10BrF4NS — CID 65279601
(3-bromo-5-methylthiophen-2-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine (PubChem CID 65279601) has the molecular formula C13H10BrF4NS and a molecular weight of 368.19 g/mol. Its IUPAC name is (3-bromo-5-methylthiophen-2-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (3-bromo-5-methylthiophen-2-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 65279601 |
| Molecular Formula | C13H10BrF4NS |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | (3-bromo-5-methylthiophen-2-yl)-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1cc(Br)c(C(N)c2ccc(F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C13H10BrF4NS/c1-6-4-9(14)12(20-6)11(19)7-2-3-10(15)8(5-7)13(16,17)18/h2-5,11H,19H2,1H3 |
| InChIKey | ZESMQKYBIRDNEH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |