C15H16N2O — CID 107293891
6-(3,3-dimethyl-2H-1-benzofuran-5-yl)pyridin-2-amine (PubChem CID 107293891) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-(3,3-dimethyl-2H-1-benzofuran-5-yl)pyridin-2-amine.
| Compound Name | 6-(3,3-dimethyl-2H-1-benzofuran-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 107293891 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 6-(3,3-dimethyl-2H-1-benzofuran-5-yl)pyridin-2-amine |
| SMILES | CC1(C)COc2ccc(-c3cccc(N)n3)cc21 |
| InChI | InChI=1S/C15H16N2O/c1-15(2)9-18-13-7-6-10(8-11(13)15)12-4-3-5-14(16)17-12/h3-8H,9H2,1-2H3,(H2,16,17) |
| InChIKey | SXGXSOVFACYHGE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |