C18H19NO — CID 107293887
6-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,3-dihydro-1H-indole (PubChem CID 107293887) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,3-dihydro-1H-indole.
| Compound Name | 6-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 107293887 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,3-dihydro-1H-indole |
| SMILES | CC1(C)COc2ccc(-c3ccc4c(c3)NCC4)cc21 |
| InChI | InChI=1S/C18H19NO/c1-18(2)11-20-17-6-5-13(9-15(17)18)14-4-3-12-7-8-19-16(12)10-14/h3-6,9-10,19H,7-8,11H2,1-2H3 |
| InChIKey | WVPFGTAKLNYETC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |