C16H15NO2 — CID 116698435
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydro-1H-indole (PubChem CID 116698435) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydro-1H-indole.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698435 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1-c1ccc3c(c1)OCCO3)NCC2 |
| InChI | InChI=1S/C16H15NO2/c1-2-12(9-14-11(1)5-6-17-14)13-3-4-15-16(10-13)19-8-7-18-15/h1-4,9-10,17H,5-8H2 |
| InChIKey | FPCFYICQSLKMPP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |