C24H19NO3S — CID 58765606
(5Z)-5-[[6-(3,3-dimethyl-2H-1-benzofuran-5-yl)naphthalen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58765606) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is (5Z)-5-[[6-(3,3-dimethyl-2H-1-benzofuran-5-yl)naphthalen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[6-(3,3-dimethyl-2H-1-benzofuran-5-yl)naphthalen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58765606 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (5Z)-5-[[6-(3,3-dimethyl-2H-1-benzofuran-5-yl)naphthalen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(C)COc2ccc(-c3ccc4cc(/C=C5\SC(=O)NC5=O)ccc4c3)cc21 |
| InChI | InChI=1S/C24H19NO3S/c1-24(2)13-28-20-8-7-18(12-19(20)24)17-6-5-15-9-14(3-4-16(15)11-17)10-21-22(26)25-23(27)29-21/h3-12H,13H2,1-2H3,(H,25,26,27)/b21-10- |
| InChIKey | QKDDCRMATKFXFK-FBHDLOMBSA-N |
| XLogP | 5.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|