C11H14ClFN2O2S2 — CID 107294823
5-amino-3-chloro-2-fluoro-N-(thiolan-3-ylmethyl)benzenesulfonamide (PubChem CID 107294823) has the molecular formula C11H14ClFN2O2S2 and a molecular weight of 324.83 g/mol. Its IUPAC name is 5-amino-3-chloro-2-fluoro-N-(thiolan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-3-chloro-2-fluoro-N-(thiolan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107294823 |
| Molecular Formula | C11H14ClFN2O2S2 |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-amino-3-chloro-2-fluoro-N-(thiolan-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)c(F)c(S(=O)(=O)NCC2CCSC2)c1 |
| InChI | InChI=1S/C11H14ClFN2O2S2/c12-9-3-8(14)4-10(11(9)13)19(16,17)15-5-7-1-2-18-6-7/h3-4,7,15H,1-2,5-6,14H2 |
| InChIKey | LVISTXUWDCQOMB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|