C10H13ClN2O2S2 — CID 107295661
4-chloro-N-(thiolan-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 107295661) has the molecular formula C10H13ClN2O2S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 4-chloro-N-(thiolan-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 4-chloro-N-(thiolan-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107295661 |
| Molecular Formula | C10H13ClN2O2S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-chloro-N-(thiolan-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCSC1)c1cnccc1Cl |
| InChI | InChI=1S/C10H13ClN2O2S2/c11-9-1-3-12-6-10(9)17(14,15)13-5-8-2-4-16-7-8/h1,3,6,8,13H,2,4-5,7H2 |
| InChIKey | WXLKTADYHZUAQV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |