C11H15ClN2S — CID 107295804
N-[(3-chloro-4-pyridinyl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107295804) has the molecular formula C11H15ClN2S and a molecular weight of 242.77 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107295804 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | Clc1cnccc1CNCC1CCSC1 |
| InChI | InChI=1S/C11H15ClN2S/c12-11-7-13-3-1-10(11)6-14-5-9-2-4-15-8-9/h1,3,7,9,14H,2,4-6,8H2 |
| InChIKey | SBCCCZHJIKKAAZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |