C9H13NO3S — CID 107298371
4-(thiolan-3-ylmethyl)morpholine-2,6-dione (PubChem CID 107298371) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-(thiolan-3-ylmethyl)morpholine-2,6-dione.
| Compound Name | 4-(thiolan-3-ylmethyl)morpholine-2,6-dione |
|---|---|
| PubChem CID | 107298371 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(thiolan-3-ylmethyl)morpholine-2,6-dione |
| SMILES | O=C1CN(CC2CCSC2)CC(=O)O1 |
| InChI | InChI=1S/C9H13NO3S/c11-8-4-10(5-9(12)13-8)3-7-1-2-14-6-7/h7H,1-6H2 |
| InChIKey | RPNVIOCLLCYAKN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|