2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride

C14H10ClN3O — CID 10730852

IUPAC2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride
SMILESCn1ccnc1-c1cc(C(=O)Cl)c2ccccc2n1
InChIInChI=1S/C14H10ClN3O/c1-18-7-6-16-14(18)12-8-10(13(15)19)9-4-2-3-5-11(9)17-12/h2-8H,1H3
InChIKeyRAQLFECRNDGRDQ-UHFFFAOYSA-N
MW271.71 g/mol
LogP3.01
Rot. Bonds2

About 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride

2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride (PubChem CID 10730852) has the molecular formula C14H10ClN3O and a molecular weight of 271.71 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride.

Molecular Properties

Compound Name2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride
PubChem CID10730852
Molecular FormulaC14H10ClN3O
Molecular Weight271.71 g/mol
Exact Mass271.05
IUPAC Name2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride
SMILESCn1ccnc1-c1cc(C(=O)Cl)c2ccccc2n1
InChIInChI=1S/C14H10ClN3O/c1-18-7-6-16-14(18)12-8-10(13(15)19)9-4-2-3-5-11(9)17-12/h2-8H,1H3
InChIKeyRAQLFECRNDGRDQ-UHFFFAOYSA-N
XLogP3.01
TPSA47.78 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.71
LogP ≤ 53.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride?
The IUPAC name of 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride (CID 10730852) is 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride.
What is the SMILES notation for 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride?
The canonical SMILES for 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride is Cn1ccnc1-c1cc(C(=O)Cl)c2ccccc2n1.
What is the InChIKey of 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride?
The InChIKey is RAQLFECRNDGRDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN3O/c1-18-7-6-16-14(18)12-8-10(13(15)19)9-4-2-3-5-11(9)17-12/h2-8H,1H3.
What are the key properties of 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride?
2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride has a molecular weight of 271.71 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylimidazol-2-yl)quinoline-4-carbonyl chloride is sourced from PubChem (CID 10730852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).