C13H12N4OS — CID 10730896
3-amino-4-methylthieno[2,3-b]quinoline-2-carbohydrazide (PubChem CID 10730896) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-amino-4-methylthieno[2,3-b]quinoline-2-carbohydrazide.
| Compound Name | 3-amino-4-methylthieno[2,3-b]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 10730896 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-amino-4-methylthieno[2,3-b]quinoline-2-carbohydrazide |
| SMILES | Cc1c2ccccc2nc2sc(C(=O)NN)c(N)c12 |
| InChI | InChI=1S/C13H12N4OS/c1-6-7-4-2-3-5-8(7)16-13-9(6)10(14)11(19-13)12(18)17-15/h2-5H,14-15H2,1H3,(H,17,18) |
| InChIKey | IBXFYDZKVKZGFP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|