C17H13Cl3O — CID 107309244
1,2-dichloro-3-[[4-(4-chlorobut-1-ynyl)phenoxy]methyl]benzene (PubChem CID 107309244) has the molecular formula C17H13Cl3O and a molecular weight of 339.65 g/mol. Its IUPAC name is 1,2-dichloro-3-[[4-(4-chlorobut-1-ynyl)phenoxy]methyl]benzene.
| Compound Name | 1,2-dichloro-3-[[4-(4-chlorobut-1-ynyl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 107309244 |
| Molecular Formula | C17H13Cl3O |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1,2-dichloro-3-[[4-(4-chlorobut-1-ynyl)phenoxy]methyl]benzene |
| SMILES | ClCCC#Cc1ccc(OCc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H13Cl3O/c18-11-2-1-4-13-7-9-15(10-8-13)21-12-14-5-3-6-16(19)17(14)20/h3,5-10H,2,11-12H2 |
| InChIKey | RVQDCEMGSNOAPC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|