C11H8Cl2N2OS — CID 107311606
2-(2,3-dichlorophenyl)-1-(4-methylthiadiazol-5-yl)ethanone (PubChem CID 107311606) has the molecular formula C11H8Cl2N2OS and a molecular weight of 287.17 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-(4-methylthiadiazol-5-yl)ethanone.
| Compound Name | 2-(2,3-dichlorophenyl)-1-(4-methylthiadiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 107311606 |
| Molecular Formula | C11H8Cl2N2OS |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-(4-methylthiadiazol-5-yl)ethanone |
| SMILES | Cc1nnsc1C(=O)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl2N2OS/c1-6-11(17-15-14-6)9(16)5-7-3-2-4-8(12)10(7)13/h2-4H,5H2,1H3 |
| InChIKey | FHTHIUXTQFFWHR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |