C14H20Cl2N2S2 — CID 107312815
[2-(2,3-dichlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine (PubChem CID 107312815) has the molecular formula C14H20Cl2N2S2 and a molecular weight of 351.37 g/mol. Its IUPAC name is [2-(2,3-dichlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,3-dichlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107312815 |
| Molecular Formula | C14H20Cl2N2S2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | [2-(2,3-dichlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine |
| SMILES | CC1SCC(C(Cc2cccc(Cl)c2Cl)NN)SC1C |
| InChI | InChI=1S/C14H20Cl2N2S2/c1-8-9(2)20-13(7-19-8)12(18-17)6-10-4-3-5-11(15)14(10)16/h3-5,8-9,12-13,18H,6-7,17H2,1-2H3 |
| InChIKey | VWESBDBPLBJWHU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|