C11H24N2O2S3 — CID 103347091
[1-(5,6-dimethyl-1,4-dithian-2-yl)-4-methylsulfonylbutyl]hydrazine (PubChem CID 103347091) has the molecular formula C11H24N2O2S3 and a molecular weight of 312.53 g/mol. Its IUPAC name is [1-(5,6-dimethyl-1,4-dithian-2-yl)-4-methylsulfonylbutyl]hydrazine.
| Compound Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-4-methylsulfonylbutyl]hydrazine |
|---|---|
| PubChem CID | 103347091 |
| Molecular Formula | C11H24N2O2S3 |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-4-methylsulfonylbutyl]hydrazine |
| SMILES | CC1SCC(C(CCCS(C)(=O)=O)NN)SC1C |
| InChI | InChI=1S/C11H24N2O2S3/c1-8-9(2)17-11(7-16-8)10(13-12)5-4-6-18(3,14)15/h8-11,13H,4-7,12H2,1-3H3 |
| InChIKey | FIYMXWCZURRUGO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|