C11H24N2S2 — CID 103347111
[1-(5,6-dimethyl-1,4-dithian-2-yl)-2,2-dimethylpropyl]hydrazine (PubChem CID 103347111) has the molecular formula C11H24N2S2 and a molecular weight of 248.46 g/mol. Its IUPAC name is [1-(5,6-dimethyl-1,4-dithian-2-yl)-2,2-dimethylpropyl]hydrazine.
| Compound Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-2,2-dimethylpropyl]hydrazine |
|---|---|
| PubChem CID | 103347111 |
| Molecular Formula | C11H24N2S2 |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-2,2-dimethylpropyl]hydrazine |
| SMILES | CC1SCC(C(NN)C(C)(C)C)SC1C |
| InChI | InChI=1S/C11H24N2S2/c1-7-8(2)15-9(6-14-7)10(13-12)11(3,4)5/h7-10,13H,6,12H2,1-5H3 |
| InChIKey | CDXSVFOQRZZYOF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|