C10H22N2OS2 — CID 103347217
[1-(5,6-dimethyl-1,4-dithian-2-yl)-2-ethoxyethyl]hydrazine (PubChem CID 103347217) has the molecular formula C10H22N2OS2 and a molecular weight of 250.43 g/mol. Its IUPAC name is [1-(5,6-dimethyl-1,4-dithian-2-yl)-2-ethoxyethyl]hydrazine.
| Compound Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-2-ethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 103347217 |
| Molecular Formula | C10H22N2OS2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-2-ethoxyethyl]hydrazine |
| SMILES | CCOCC(NN)C1CSC(C)C(C)S1 |
| InChI | InChI=1S/C10H22N2OS2/c1-4-13-5-9(12-11)10-6-14-7(2)8(3)15-10/h7-10,12H,4-6,11H2,1-3H3 |
| InChIKey | GPYMMRUJOONKJU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|