C9H19NS2 — CID 103347015
(1R)-1-(5,6-dimethyl-1,4-dithian-2-yl)propan-1-amine (PubChem CID 103347015) has the molecular formula C9H19NS2 and a molecular weight of 205.39 g/mol. Its IUPAC name is (1R)-1-(5,6-dimethyl-1,4-dithian-2-yl)propan-1-amine.
| Compound Name | (1R)-1-(5,6-dimethyl-1,4-dithian-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 103347015 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (1R)-1-(5,6-dimethyl-1,4-dithian-2-yl)propan-1-amine |
| SMILES | CC[C@@H](N)C1CSC(C)C(C)S1 |
| InChI | InChI=1S/C9H19NS2/c1-4-8(10)9-5-11-6(2)7(3)12-9/h6-9H,4-5,10H2,1-3H3/t6?,7?,8-,9?/m1/s1 |
| InChIKey | BAGHFJKUKZIHPI-DIVUHBNLSA-N |
| XLogP | 2.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |