C14H11ClN2O4 — CID 107314458
(2R)-2-(2-chlorophenyl)-2-[(3-hydroxypyridine-4-carbonyl)amino]acetic acid (PubChem CID 107314458) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-[(3-hydroxypyridine-4-carbonyl)amino]acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-[(3-hydroxypyridine-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 107314458 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-[(3-hydroxypyridine-4-carbonyl)amino]acetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)c1ccccc1Cl)c1ccncc1O |
| InChI | InChI=1S/C14H11ClN2O4/c15-10-4-2-1-3-8(10)12(14(20)21)17-13(19)9-5-6-16-7-11(9)18/h1-7,12,18H,(H,17,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | QGXPVMKDNSCECH-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |