C17H19N3O — CID 107314628
1-(ethylamino)-3-quinolin-7-yloxycyclopentane-1-carbonitrile (PubChem CID 107314628) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(ethylamino)-3-quinolin-7-yloxycyclopentane-1-carbonitrile.
| Compound Name | 1-(ethylamino)-3-quinolin-7-yloxycyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 107314628 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-(ethylamino)-3-quinolin-7-yloxycyclopentane-1-carbonitrile |
| SMILES | CCNC1(C#N)CCC(Oc2ccc3cccnc3c2)C1 |
| InChI | InChI=1S/C17H19N3O/c1-2-20-17(12-18)8-7-15(11-17)21-14-6-5-13-4-3-9-19-16(13)10-14/h3-6,9-10,15,20H,2,7-8,11H2,1H3 |
| InChIKey | GWKUEDYALQQCKB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |