C18H20OS — CID 10731804
3,15-dimethyl-8-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-ol (PubChem CID 10731804) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is 3,15-dimethyl-8-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-ol.
| Compound Name | 3,15-dimethyl-8-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-ol |
|---|---|
| PubChem CID | 10731804 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3,15-dimethyl-8-methylsulfanyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-ol |
| SMILES | CSC1c2cccc(C)c2-c2c(C)cccc2CC1O |
| InChI | InChI=1S/C18H20OS/c1-11-6-4-8-13-10-15(19)18(20-3)14-9-5-7-12(2)17(14)16(11)13/h4-9,15,18-19H,10H2,1-3H3 |
| InChIKey | YAQAGCQWCGDYPV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |