C17H22O2S — CID 10732271
(2S,3R,5S)-4,4-dimethyl-15λ6-thiatetracyclo[8.4.1.13,5.02,7]hexadeca-7,11,13-triene 15,15-dioxide (PubChem CID 10732271) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is (2S,3R,5S)-4,4-dimethyl-15λ6-thiatetracyclo[8.4.1.13,5.02,7]hexadeca-7,11,13-triene 15,15-dioxide.
| Compound Name | (2S,3R,5S)-4,4-dimethyl-15λ6-thiatetracyclo[8.4.1.13,5.02,7]hexadeca-7,11,13-triene 15,15-dioxide |
|---|---|
| PubChem CID | 10732271 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S,3R,5S)-4,4-dimethyl-15λ6-thiatetracyclo[8.4.1.13,5.02,7]hexadeca-7,11,13-triene 15,15-dioxide |
| SMILES | CC1(C)[C@@H]2CC3=CCC4C=CC=CC([C@H]3[C@H]1C2)S4(=O)=O |
| InChI | InChI=1S/C17H22O2S/c1-17(2)12-9-11-7-8-13-5-3-4-6-15(20(13,18)19)16(11)14(17)10-12/h3-7,12-16H,8-10H2,1-2H3/t12-,13?,14-,15?,16-/m1/s1 |
| InChIKey | PNJBRLZSXACCED-WEIUDFCLSA-N |
| XLogP | 3.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|