C14H22O2S — CID 10354981
6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-3,6-dihydro-2H-thiopyran 1,1-dioxide (PubChem CID 10354981) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is 6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-3,6-dihydro-2H-thiopyran 1,1-dioxide.
| Compound Name | 6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-3,6-dihydro-2H-thiopyran 1,1-dioxide |
|---|---|
| PubChem CID | 10354981 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-3,6-dihydro-2H-thiopyran 1,1-dioxide |
| SMILES | CC1(C)[C@H]2CC[C@H](C3C=CCCS3(=O)=O)[C@@H]1C2 |
| InChI | InChI=1S/C14H22O2S/c1-14(2)10-6-7-11(12(14)9-10)13-5-3-4-8-17(13,15)16/h3,5,10-13H,4,6-9H2,1-2H3/t10-,11-,12-,13?/m0/s1 |
| InChIKey | HDDVECSUXSIRGT-TXRDPFJMSA-N |
| XLogP | 2.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|