C19H34O2S — CID 135756365
(1S,2S,4R)-4-methyl-1-propan-2-yl-2-[(E,3S)-3-prop-2-enylsulfonylhex-1-enyl]cyclohexane (PubChem CID 135756365) has the molecular formula C19H34O2S and a molecular weight of 326.55 g/mol. Its IUPAC name is (1S,2S,4R)-4-methyl-1-propan-2-yl-2-[(E,3S)-3-prop-2-enylsulfonylhex-1-enyl]cyclohexane.
| Compound Name | (1S,2S,4R)-4-methyl-1-propan-2-yl-2-[(E,3S)-3-prop-2-enylsulfonylhex-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 135756365 |
| Molecular Formula | C19H34O2S |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (1S,2S,4R)-4-methyl-1-propan-2-yl-2-[(E,3S)-3-prop-2-enylsulfonylhex-1-enyl]cyclohexane |
| SMILES | C=CCS(=O)(=O)[C@H](/C=C/[C@@H]1C[C@H](C)CC[C@H]1C(C)C)CCC |
| InChI | InChI=1S/C19H34O2S/c1-6-8-18(22(20,21)13-7-2)11-10-17-14-16(5)9-12-19(17)15(3)4/h7,10-11,15-19H,2,6,8-9,12-14H2,1,3-5H3/b11-10+/t16-,17-,18+,19+/m1/s1 |
| InChIKey | URAVPWHSDGLPJA-MMUSYCIZSA-N |
| XLogP | 5.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|