C27H50O4 — CID 69416859
2-(2-hydroxyethoxy)ethyl 3-(5-methyl-2-propan-2-ylcyclohexyl)prop-2-enoate;1-methyl-4-propan-2-ylcyclohexane (PubChem CID 69416859) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 3-(5-methyl-2-propan-2-ylcyclohexyl)prop-2-enoate;1-methyl-4-propan-2-ylcyclohexane.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 3-(5-methyl-2-propan-2-ylcyclohexyl)prop-2-enoate;1-methyl-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 69416859 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 3-(5-methyl-2-propan-2-ylcyclohexyl)prop-2-enoate;1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC1CCC(C(C)C)C(C=CC(=O)OCCOCCO)C1.CC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C17H30O4.C10H20/c1-13(2)16-6-4-14(3)12-15(16)5-7-17(19)21-11-10-20-9-8-18;1-8(2)10-6-4-9(3)5-7-10/h5,7,13-16,18H,4,6,8-12H2,1-3H3;8-10H,4-7H2,1-3H3 |
| InChIKey | BXFWNQNCPOODNV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|