C12H20O4S2 — CID 54344047
5,6-bis(methylsulfonylmethyl)bicyclo[2.2.2]oct-2-ene (PubChem CID 54344047) has the molecular formula C12H20O4S2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 5,6-bis(methylsulfonylmethyl)bicyclo[2.2.2]oct-2-ene.
| Compound Name | 5,6-bis(methylsulfonylmethyl)bicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 54344047 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5,6-bis(methylsulfonylmethyl)bicyclo[2.2.2]oct-2-ene |
| SMILES | CS(=O)(=O)CC1C2C=CC(CC2)C1CS(C)(=O)=O |
| InChI | InChI=1S/C12H20O4S2/c1-17(13,14)7-11-9-3-5-10(6-4-9)12(11)8-18(2,15)16/h3,5,9-12H,4,6-8H2,1-2H3 |
| InChIKey | UBAGOSUYNSJAGL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|