C14H22O4S2 — CID 13225298
(1S,2R,6R,7R)-6-butylsulfonyl-3lambda6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide (PubChem CID 13225298) has the molecular formula C14H22O4S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,2R,6R,7R)-6-butylsulfonyl-3lambda6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide.
| Compound Name | (1S,2R,6R,7R)-6-butylsulfonyl-3lambda6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide |
|---|---|
| PubChem CID | 13225298 |
| Molecular Formula | C14H22O4S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (1S,2R,6R,7R)-6-butylsulfonyl-3lambda6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide |
| SMILES | CCCCS(=O)(=O)[C@@]12CCS(=O)(=O)[C@@H]1[C@@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C14H22O4S2/c1-2-3-9-20(17,18)14-8-10-19(15,16)13(14)11-4-6-12(14)7-5-11/h4,6,11-13H,2-3,5,7-10H2,1H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | VEWBMDSJBMBXOS-XJFOESAGSA-N |
| XLogP | 1.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|