C10H14O2S — CID 10241849
(1R,7S)-3λ6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide (PubChem CID 10241849) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is (1R,7S)-3λ6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide.
| Compound Name | (1R,7S)-3λ6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide |
|---|---|
| PubChem CID | 10241849 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (1R,7S)-3λ6-thiatricyclo[5.2.2.02,6]undec-8-ene 3,3-dioxide |
| SMILES | O=S1(=O)CCC2C1[C@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C10H14O2S/c11-13(12)6-5-9-7-1-3-8(4-2-7)10(9)13/h1,3,7-10H,2,4-6H2/t7-,8+,9?,10?/m1/s1 |
| InChIKey | DXVRXYKJPYFGNE-XHHQTKHESA-N |
| XLogP | 1.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|