C10H14S — CID 98156853
(1R,2S,6S,7R)-4-thiatricyclo[5.2.2.02,6]undec-8-ene (PubChem CID 98156853) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-thiatricyclo[5.2.2.02,6]undec-8-ene.
| Compound Name | (1R,2S,6S,7R)-4-thiatricyclo[5.2.2.02,6]undec-8-ene |
|---|---|
| PubChem CID | 98156853 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (1R,2S,6S,7R)-4-thiatricyclo[5.2.2.02,6]undec-8-ene |
| SMILES | C1=C[C@H]2CC[C@H]1[C@@H]1CSC[C@H]12 |
| InChI | InChI=1S/C10H14S/c1-2-8-4-3-7(1)9-5-11-6-10(8)9/h1-2,7-10H,3-6H2/t7-,8-,9-,10-/m0/s1 |
| InChIKey | JXDOOALAVGXVII-XKNYDFJKSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|