C12H12O4S2 — CID 134976032
3λ6,9λ6-dithiatetracyclo[5.5.2.02,6.08,12]tetradeca-4,10,13-triene 3,3,9,9-tetraoxide (PubChem CID 134976032) has the molecular formula C12H12O4S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3λ6,9λ6-dithiatetracyclo[5.5.2.02,6.08,12]tetradeca-4,10,13-triene 3,3,9,9-tetraoxide.
| Compound Name | 3λ6,9λ6-dithiatetracyclo[5.5.2.02,6.08,12]tetradeca-4,10,13-triene 3,3,9,9-tetraoxide |
|---|---|
| PubChem CID | 134976032 |
| Molecular Formula | C12H12O4S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3λ6,9λ6-dithiatetracyclo[5.5.2.02,6.08,12]tetradeca-4,10,13-triene 3,3,9,9-tetraoxide |
| SMILES | O=S1(=O)C=CC2C3C=CC(C4C=CS(=O)(=O)C34)C21 |
| InChI | InChI=1S/C12H12O4S2/c13-17(14)6-4-10-8-2-1-7(11(10)17)9-3-5-18(15,16)12(8)9/h1-12H |
| InChIKey | YADOCJWDVSXKIQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|