C26H42O4S2 — CID 123187635
1-(cyclohexen-1-ylsulfonyl)-4-cyclohex-2-en-1-ylsulfonyl-5-methyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene (PubChem CID 123187635) has the molecular formula C26H42O4S2 and a molecular weight of 482.75 g/mol. Its IUPAC name is 1-(cyclohexen-1-ylsulfonyl)-4-cyclohex-2-en-1-ylsulfonyl-5-methyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene.
| Compound Name | 1-(cyclohexen-1-ylsulfonyl)-4-cyclohex-2-en-1-ylsulfonyl-5-methyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene |
|---|---|
| PubChem CID | 123187635 |
| Molecular Formula | C26H42O4S2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 1-(cyclohexen-1-ylsulfonyl)-4-cyclohex-2-en-1-ylsulfonyl-5-methyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene |
| SMILES | CC1CCCCCCC2C1C(S(=O)(=O)C1C=CCCC1)CCC2S(=O)(=O)C1=CCCCC1 |
| InChI | InChI=1S/C26H42O4S2/c1-20-12-6-2-3-11-17-23-24(31(27,28)21-13-7-4-8-14-21)18-19-25(26(20)23)32(29,30)22-15-9-5-10-16-22/h9,13,15,20,22-26H,2-8,10-12,14,16-19H2,1H3 |
| InChIKey | UZPGKWMHHQTUDL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|