C31H52O4S2 — CID 123602682
12-cyclohex-2-en-1-ylsulfonyl-15-(8-methylnona-2,7-dien-4-ylsulfonyl)bicyclo[9.4.0]pentadecane (PubChem CID 123602682) has the molecular formula C31H52O4S2 and a molecular weight of 552.89 g/mol. Its IUPAC name is 12-cyclohex-2-en-1-ylsulfonyl-15-(8-methylnona-2,7-dien-4-ylsulfonyl)bicyclo[9.4.0]pentadecane.
| Compound Name | 12-cyclohex-2-en-1-ylsulfonyl-15-(8-methylnona-2,7-dien-4-ylsulfonyl)bicyclo[9.4.0]pentadecane |
|---|---|
| PubChem CID | 123602682 |
| Molecular Formula | C31H52O4S2 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | 12-cyclohex-2-en-1-ylsulfonyl-15-(8-methylnona-2,7-dien-4-ylsulfonyl)bicyclo[9.4.0]pentadecane |
| SMILES | CC=CC(CCC=C(C)C)S(=O)(=O)C1CCC(S(=O)(=O)C2C=CCCC2)C2CCCCCCCCCC21 |
| InChI | InChI=1S/C31H52O4S2/c1-4-16-26(20-15-17-25(2)3)36(32,33)30-23-24-31(37(34,35)27-18-11-10-12-19-27)29-22-14-9-7-5-6-8-13-21-28(29)30/h4,11,16-18,26-31H,5-10,12-15,19-24H2,1-3H3 |
| InChIKey | BZLOKBJFTHGKNK-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|