C28H48O4S2 — CID 123211705
1-cyclohexylsulfonyl-4-(4-ethylcyclohept-3-en-1-yl)sulfonyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene (PubChem CID 123211705) has the molecular formula C28H48O4S2 and a molecular weight of 512.82 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-4-(4-ethylcyclohept-3-en-1-yl)sulfonyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene.
| Compound Name | 1-cyclohexylsulfonyl-4-(4-ethylcyclohept-3-en-1-yl)sulfonyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene |
|---|---|
| PubChem CID | 123211705 |
| Molecular Formula | C28H48O4S2 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 1-cyclohexylsulfonyl-4-(4-ethylcyclohept-3-en-1-yl)sulfonyl-2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulene |
| SMILES | CCC1=CCC(S(=O)(=O)C2CCC(S(=O)(=O)C3CCCCC3)C3CCCCCCCC32)CCC1 |
| InChI | InChI=1S/C28H48O4S2/c1-2-22-12-11-15-24(19-18-22)34(31,32)28-21-20-27(33(29,30)23-13-7-6-8-14-23)25-16-9-4-3-5-10-17-26(25)28/h18,23-28H,2-17,19-21H2,1H3 |
| InChIKey | JTFVBGHKUZZCGS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|