C12H14O2S — CID 98163641
(1R,2R,6R,7R,8S,11S)-4λ6-thiatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene 4,4-dioxide (PubChem CID 98163641) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is (1R,2R,6R,7R,8S,11S)-4λ6-thiatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene 4,4-dioxide.
| Compound Name | (1R,2R,6R,7R,8S,11S)-4λ6-thiatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene 4,4-dioxide |
|---|---|
| PubChem CID | 98163641 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (1R,2R,6R,7R,8S,11S)-4λ6-thiatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene 4,4-dioxide |
| SMILES | O=S1(=O)C[C@@H]2[C@@H]3C=C[C@H]([C@H]4C=C[C@@H]43)[C@H]2C1 |
| InChI | InChI=1S/C12H14O2S/c13-15(14)5-11-9-3-4-10(12(11)6-15)8-2-1-7(8)9/h1-4,7-12H,5-6H2/t7-,8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | XVHVDAARNKCOKB-WGWHJZDNSA-N |
| XLogP | 1.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|