About 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride
3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride (PubChem CID 170907548) has the molecular formula C5H10ClNO2S
and a molecular weight of 183.66 g/mol. Its IUPAC name is 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride.
Analyze 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride?
The IUPAC name of 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride (CID 170907548) is 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride.
What is the SMILES notation for 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride?
The canonical SMILES for 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride is Cl.O=S1(=O)CC2CC(C1)N2.
What is the InChIKey of 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride?
The InChIKey is VWBRWNUOLMAJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2S.ClH/c7-9(8)2-4-1-5(3-9)6-4;/h4-6H,1-3H2;1H.
What are the key properties of 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride?
3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride has a molecular weight of 183.66 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3λ6-thia-6-azabicyclo[3.1.1]heptane 3,3-dioxide;hydrochloride is sourced from PubChem (CID 170907548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).