C4H12Cl2N2O2S — CID 21206173
[(3S,4S)-4-azaniumyl-1,1-dioxothiolan-3-yl]azanium dichloride (PubChem CID 21206173) has the molecular formula C4H12Cl2N2O2S and a molecular weight of 223.12 g/mol. Its IUPAC name is [(3S,4S)-4-azaniumyl-1,1-dioxothiolan-3-yl]azanium dichloride.
| Compound Name | [(3S,4S)-4-azaniumyl-1,1-dioxothiolan-3-yl]azanium dichloride |
|---|---|
| PubChem CID | 21206173 |
| Molecular Formula | C4H12Cl2N2O2S |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | [(3S,4S)-4-azaniumyl-1,1-dioxothiolan-3-yl]azanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+][C@@H]1CS(=O)(=O)C[C@H]1[NH3+] |
| InChI | InChI=1S/C4H10N2O2S.2ClH/c5-3-1-9(7,8)2-4(3)6;;/h3-4H,1-2,5-6H2;2*1H/t3-,4-;;/m1../s1 |
| InChIKey | UYORTFNECMHCAN-XWJKVJTJSA-N |
| XLogP | -9.36 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | -9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |