About [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium
[(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium (PubChem CID 7226882) has the molecular formula C6H13N2O3S+
and a molecular weight of 193.25 g/mol. Its IUPAC name is [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium.
Molecular Properties
| Compound Name | [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium |
| PubChem CID | 7226882 |
| Molecular Formula | C6H13N2O3S+ |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium |
| SMILES | CC(=O)N[C@H]1CS(=O)(=O)C[C@H]1[NH3+] |
| InChI | InChI=1S/C6H12N2O3S/c1-4(9)8-6-3-12(10,11)2-5(6)7/h5-6H,2-3,7H2,1H3,(H,8,9)/p+1/t5-,6+/m1/s1 |
| InChIKey | PYCIQDKQSSQWKD-RITPCOANSA-O |
| XLogP | -2.47 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium?
The IUPAC name of [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium (CID 7226882) is [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium.
What is the SMILES notation for [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium?
The canonical SMILES for [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium is CC(=O)N[C@H]1CS(=O)(=O)C[C@H]1[NH3+].
What is the InChIKey of [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium?
The InChIKey is PYCIQDKQSSQWKD-RITPCOANSA-O. The full InChI is InChI=1S/C6H12N2O3S/c1-4(9)8-6-3-12(10,11)2-5(6)7/h5-6H,2-3,7H2,1H3,(H,8,9)/p+1/t5-,6+/m1/s1.
What are the key properties of [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium?
[(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium has a molecular weight of 193.25 g/mol, XLogP of -2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium is sourced from PubChem (CID 7226882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).