C6H13N2O3S+ — CID 7226882
[(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium (PubChem CID 7226882) has the molecular formula C6H13N2O3S+ and a molecular weight of 193.25 g/mol. Its IUPAC name is [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium.
| Compound Name | [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium |
|---|---|
| PubChem CID | 7226882 |
| Molecular Formula | C6H13N2O3S+ |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | [(3S,4R)-4-acetamido-1,1-dioxothiolan-3-yl]azanium |
| SMILES | CC(=O)N[C@H]1CS(=O)(=O)C[C@H]1[NH3+] |
| InChI | InChI=1S/C6H12N2O3S/c1-4(9)8-6-3-12(10,11)2-5(6)7/h5-6H,2-3,7H2,1H3,(H,8,9)/p+1/t5-,6+/m1/s1 |
| InChIKey | PYCIQDKQSSQWKD-RITPCOANSA-O |
| XLogP | -2.47 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |