C12H15N3O4 — CID 107323207
3-amino-1-(3-methoxypyridine-4-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 107323207) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-amino-1-(3-methoxypyridine-4-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(3-methoxypyridine-4-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107323207 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-amino-1-(3-methoxypyridine-4-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1cnccc1C(=O)N1CCC(N)(C(=O)O)C1 |
| InChI | InChI=1S/C12H15N3O4/c1-19-9-6-14-4-2-8(9)10(16)15-5-3-12(13,7-15)11(17)18/h2,4,6H,3,5,7,13H2,1H3,(H,17,18) |
| InChIKey | XSLZHBFBTFDENX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |