C16H22N2O4 — CID 131689296
(3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(3-methoxy-4-pyridinyl)methanone (PubChem CID 131689296) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(3-methoxy-4-pyridinyl)methanone.
| Compound Name | (3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(3-methoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 131689296 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(3-methoxy-4-pyridinyl)methanone |
| SMILES | COc1cnccc1C(=O)N1CCC2(CC1)CC(OC)CO2 |
| InChI | InChI=1S/C16H22N2O4/c1-20-12-9-16(22-11-12)4-7-18(8-5-16)15(19)13-3-6-17-10-14(13)21-2/h3,6,10,12H,4-5,7-9,11H2,1-2H3 |
| InChIKey | LKZQKKZUWKTAIC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |